![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 00. Burning Heads - Dive.nfo | 2024-10-24 01:29 | 1.9K | |
| 00. Burning Heads - Dive.sfv | 2024-10-24 01:29 | 492 | |
| 01. Reaction.mp3 | 2024-10-24 01:29 | 4.6M | |
| 02. Few Words.mp3 | 2024-10-24 01:29 | 3.9M | |
| 03. Piece Of Cake.mp3 | 2024-10-24 01:29 | 4.7M | |
| 04. Help.mp3 | 2024-10-24 01:29 | 6.0M | |
| 05. Sitting In My Room.mp3 | 2024-10-24 01:29 | 3.8M | |
| 06. Bad Trip.mp3 | 2024-10-24 01:29 | 3.9M | |
| 07. Queen America.mp3 | 2024-10-24 01:29 | 4.1M | |
| 08. I Don't Like Your Party.mp3 | 2024-10-24 01:29 | 3.7M | |
| 09. Dance Of The Ghosts.mp3 | 2024-10-24 01:29 | 6.4M | |
| 10. Mr. White.mp3 | 2024-10-24 01:29 | 1.9M | |
| 11. Don't Wait For Me.mp3 | 2024-10-24 01:29 | 2.9M | |
| 12. Xtra Stwrong.mp3 | 2024-10-24 01:29 | 3.1M | |
| 13. Promises.mp3 | 2024-10-24 01:29 | 5.1M | |
| Burning Heads - Dive.m3u | 2024-10-24 01:29 | 291 | |